C5H12ClNO — CID 56845289
cis-(1R,3S)-3-aminocyclopentan-1-ol;hydrochloride (PubChem CID 56845289) has the molecular formula C5H12ClNO and a molecular weight of 137.61 g/mol. Its IUPAC name is cis-(1R,3S)-3-aminocyclopentan-1-ol;hydrochloride.
| Compound Name | cis-(1R,3S)-3-aminocyclopentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 56845289 |
| Molecular Formula | C5H12ClNO |
| Molecular Weight | 137.61 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | cis-(1R,3S)-3-aminocyclopentan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H]1CC[C@@H](O)C1 |
| InChI | InChI=1S/C5H11NO.ClH/c6-4-1-2-5(7)3-4;/h4-5,7H,1-3,6H2;1H/t4-,5+;/m0./s1 |
| InChIKey | SGKRJNWIEGYWGE-UYXJWNHNSA-N |
| XLogP | 0.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.61 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |