C6H14N2O — CID 55289345
(1S,2S,4S)-2,4-diaminocyclohexan-1-ol (PubChem CID 55289345) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is (1S,2S,4S)-2,4-diaminocyclohexan-1-ol.
| Compound Name | (1S,2S,4S)-2,4-diaminocyclohexan-1-ol |
|---|---|
| PubChem CID | 55289345 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | (1S,2S,4S)-2,4-diaminocyclohexan-1-ol |
| SMILES | N[C@H]1CC[C@H](O)[C@@H](N)C1 |
| InChI | InChI=1S/C6H14N2O/c7-4-1-2-6(9)5(8)3-4/h4-6,9H,1-3,7-8H2/t4-,5-,6-/m0/s1 |
| InChIKey | GLNQKYXXXHMERA-ZLUOBGJFSA-N |
| XLogP | -0.81 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |