C7H15NO — CID 124537900
(1S,2R,4S)-4-amino-2-methylcyclohexan-1-ol (PubChem CID 124537900) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (1S,2R,4S)-4-amino-2-methylcyclohexan-1-ol.
| Compound Name | (1S,2R,4S)-4-amino-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 124537900 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (1S,2R,4S)-4-amino-2-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1C[C@@H](N)CC[C@@H]1O |
| InChI | InChI=1S/C7H15NO/c1-5-4-6(8)2-3-7(5)9/h5-7,9H,2-4,8H2,1H3/t5-,6+,7+/m1/s1 |
| InChIKey | GEVHPGXCGOVPDK-VQVTYTSYSA-N |
| XLogP | 0.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |