C6H13ClFNO — CID 138629032
(1R,2S,4R)-4-amino-2-fluorocyclohexan-1-ol;hydrochloride (PubChem CID 138629032) has the molecular formula C6H13ClFNO and a molecular weight of 169.63 g/mol. Its IUPAC name is (1R,2S,4R)-4-amino-2-fluorocyclohexan-1-ol;hydrochloride.
| Compound Name | (1R,2S,4R)-4-amino-2-fluorocyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 138629032 |
| Molecular Formula | C6H13ClFNO |
| Molecular Weight | 169.63 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (1R,2S,4R)-4-amino-2-fluorocyclohexan-1-ol;hydrochloride |
| SMILES | Cl.N[C@@H]1CC[C@@H](O)[C@@H](F)C1 |
| InChI | InChI=1S/C6H12FNO.ClH/c7-5-3-4(8)1-2-6(5)9;/h4-6,9H,1-3,8H2;1H/t4-,5+,6-;/m1./s1 |
| InChIKey | NIJACTPTLYNFSD-KJESCUSBSA-N |
| XLogP | 0.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.63 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |