C10H19FO — CID 130452306
trans-(1R,2R)-4-tert-butyl-2-fluorocyclohexan-1-ol (PubChem CID 130452306) has the molecular formula C10H19FO and a molecular weight of 174.26 g/mol. Its IUPAC name is trans-(1R,2R)-4-tert-butyl-2-fluorocyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-4-tert-butyl-2-fluorocyclohexan-1-ol |
|---|---|
| PubChem CID | 130452306 |
| Molecular Formula | C10H19FO |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | trans-(1R,2R)-4-tert-butyl-2-fluorocyclohexan-1-ol |
| SMILES | CC(C)(C)C1CC[C@@H](O)[C@H](F)C1 |
| InChI | InChI=1S/C10H19FO/c1-10(2,3)7-4-5-9(12)8(11)6-7/h7-9,12H,4-6H2,1-3H3/t7?,8-,9-/m1/s1 |
| InChIKey | IFEZWVWUOROMDE-CFCGPWAMSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |