C13H28OSi — CID 12632631
(1R,2S,5S)-5-tert-butyl-2-deuterio-2-trimethylsilylcyclohexan-1-ol (PubChem CID 12632631) has the molecular formula C13H28OSi and a molecular weight of 229.46 g/mol. Its IUPAC name is (1R,2S,5S)-5-tert-butyl-2-deuterio-2-trimethylsilylcyclohexan-1-ol.
| Compound Name | (1R,2S,5S)-5-tert-butyl-2-deuterio-2-trimethylsilylcyclohexan-1-ol |
|---|---|
| PubChem CID | 12632631 |
| Molecular Formula | C13H28OSi |
| Molecular Weight | 229.46 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | (1R,2S,5S)-5-tert-butyl-2-deuterio-2-trimethylsilylcyclohexan-1-ol |
| SMILES | [2H][C@]1([Si](C)(C)C)CC[C@H](C(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C13H28OSi/c1-13(2,3)10-7-8-12(11(14)9-10)15(4,5)6/h10-12,14H,7-9H2,1-6H3/t10-,11+,12-/m0/s1/i12D |
| InChIKey | UNPIWWPINOKEAY-OSJRCPBUSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|