C17H38 — CID 161179598
1,3-ditert-butylcyclopentane;ethane (PubChem CID 161179598) has the molecular formula C17H38 and a molecular weight of 242.49 g/mol. Its IUPAC name is 1,3-ditert-butylcyclopentane;ethane.
| Compound Name | 1,3-ditert-butylcyclopentane;ethane |
|---|---|
| PubChem CID | 161179598 |
| Molecular Formula | C17H38 |
| Molecular Weight | 242.49 g/mol |
| Exact Mass | 242.30 |
| IUPAC Name | 1,3-ditert-butylcyclopentane;ethane |
| SMILES | CC.CC.CC(C)(C)C1CCC(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H26.2C2H6/c1-12(2,3)10-7-8-11(9-10)13(4,5)6;2*1-2/h10-11H,7-9H2,1-6H3;2*1-2H3 |
| InChIKey | USGPKMGTJKCRHE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |