C11H21Br — CID 15169266
(1S,2S,4R)-1-bromo-4-tert-butyl-2-methylcyclohexane (PubChem CID 15169266) has the molecular formula C11H21Br and a molecular weight of 233.19 g/mol. Its IUPAC name is (1S,2S,4R)-1-bromo-4-tert-butyl-2-methylcyclohexane.
| Compound Name | (1S,2S,4R)-1-bromo-4-tert-butyl-2-methylcyclohexane |
|---|---|
| PubChem CID | 15169266 |
| Molecular Formula | C11H21Br |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (1S,2S,4R)-1-bromo-4-tert-butyl-2-methylcyclohexane |
| SMILES | C[C@H]1C[C@H](C(C)(C)C)CC[C@@H]1Br |
| InChI | InChI=1S/C11H21Br/c1-8-7-9(11(2,3)4)5-6-10(8)12/h8-10H,5-7H2,1-4H3/t8-,9+,10-/m0/s1 |
| InChIKey | MKHVQBRDFWXHPP-AEJSXWLSSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|