C30H60 — CID 158485591
1,4-ditert-butylcyclohexane;bis(1,4-dimethylcyclohexane) (PubChem CID 158485591) has the molecular formula C30H60 and a molecular weight of 420.81 g/mol. Its IUPAC name is 1,4-ditert-butylcyclohexane;bis(1,4-dimethylcyclohexane).
| Compound Name | 1,4-ditert-butylcyclohexane;bis(1,4-dimethylcyclohexane) |
|---|---|
| PubChem CID | 158485591 |
| Molecular Formula | C30H60 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.47 |
| IUPAC Name | 1,4-ditert-butylcyclohexane;bis(1,4-dimethylcyclohexane) |
| SMILES | CC(C)(C)C1CCC(C(C)(C)C)CC1.CC1CCC(C)CC1.CC1CCC(C)CC1 |
| InChI | InChI=1S/C14H28.2C8H16/c1-13(2,3)11-7-9-12(10-8-11)14(4,5)6;2*1-7-3-5-8(2)6-4-7/h11-12H,7-10H2,1-6H3;2*7-8H,3-6H2,1-2H3 |
| InChIKey | HIBDGOXNMVORNT-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |