C15H30 — CID 58579546
1,4-ditert-butylcycloheptane (PubChem CID 58579546) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is 1,4-ditert-butylcycloheptane.
| Compound Name | 1,4-ditert-butylcycloheptane |
|---|---|
| PubChem CID | 58579546 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 1,4-ditert-butylcycloheptane |
| SMILES | CC(C)(C)C1CCCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30/c1-14(2,3)12-8-7-9-13(11-10-12)15(4,5)6/h12-13H,7-11H2,1-6H3 |
| InChIKey | YYXNSCLZEDILLE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |