C29H56 — CID 167686199
2-tert-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;tert-butylcyclobutane;tert-butylcyclopropane (PubChem CID 167686199) has the molecular formula C29H56 and a molecular weight of 404.77 g/mol. Its IUPAC name is 2-tert-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;tert-butylcyclobutane;tert-butylcyclopropane.
| Compound Name | 2-tert-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;tert-butylcyclobutane;tert-butylcyclopropane |
|---|---|
| PubChem CID | 167686199 |
| Molecular Formula | C29H56 |
| Molecular Weight | 404.77 g/mol |
| Exact Mass | 404.44 |
| IUPAC Name | 2-tert-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;tert-butylcyclobutane;tert-butylcyclopropane |
| SMILES | CC(C)(C)C1CC1.CC(C)(C)C1CCC1.CC(C)(C)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C14H26.C8H16.C7H14/c1-14(2,3)13-9-8-11-6-4-5-7-12(11)10-13;1-8(2,3)7-5-4-6-7;1-7(2,3)6-4-5-6/h11-13H,4-10H2,1-3H3;7H,4-6H2,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | WGFZLRBSDLVACD-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.77 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |