C14H30S — CID 159387743
1,3-ditert-butylcyclohexane;sulfane (PubChem CID 159387743) has the molecular formula C14H30S and a molecular weight of 230.46 g/mol. Its IUPAC name is 1,3-ditert-butylcyclohexane;sulfane.
| Compound Name | 1,3-ditert-butylcyclohexane;sulfane |
|---|---|
| PubChem CID | 159387743 |
| Molecular Formula | C14H30S |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 1,3-ditert-butylcyclohexane;sulfane |
| SMILES | CC(C)(C)C1CCCC(C(C)(C)C)C1.S |
| InChI | InChI=1S/C14H28.H2S/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6;/h11-12H,7-10H2,1-6H3;1H2 |
| InChIKey | LLSGQUJZOMIPJO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |