C16H32 — CID 160905619
tert-butylcyclopentane;tert-butylcyclopropane (PubChem CID 160905619) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is tert-butylcyclopentane;tert-butylcyclopropane.
| Compound Name | tert-butylcyclopentane;tert-butylcyclopropane |
|---|---|
| PubChem CID | 160905619 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | tert-butylcyclopentane;tert-butylcyclopropane |
| SMILES | CC(C)(C)C1CC1.CC(C)(C)C1CCCC1 |
| InChI | InChI=1S/C9H18.C7H14/c1-9(2,3)8-6-4-5-7-8;1-7(2,3)6-4-5-6/h8H,4-7H2,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | SQCGRTNOWDWVPX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |