About tert-butylcyclohexane;sulfuryl dichloride
tert-butylcyclohexane;sulfuryl dichloride (PubChem CID 175416889) has the molecular formula C10H20Cl2O2S
and a molecular weight of 275.24 g/mol. Its IUPAC name is tert-butylcyclohexane;sulfuryl dichloride.
Molecular Properties
| Compound Name | tert-butylcyclohexane;sulfuryl dichloride |
| PubChem CID | 175416889 |
| Molecular Formula | C10H20Cl2O2S |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | tert-butylcyclohexane;sulfuryl dichloride |
| SMILES | CC(C)(C)C1CCCCC1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C10H20.Cl2O2S/c1-10(2,3)9-7-5-4-6-8-9;1-5(2,3)4/h9H,4-8H2,1-3H3; |
| InChIKey | SQQKRLXLFSAEGC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butylcyclohexane;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylcyclohexane;sulfuryl dichloride?
The IUPAC name of tert-butylcyclohexane;sulfuryl dichloride (CID 175416889) is tert-butylcyclohexane;sulfuryl dichloride.
What is the SMILES notation for tert-butylcyclohexane;sulfuryl dichloride?
The canonical SMILES for tert-butylcyclohexane;sulfuryl dichloride is CC(C)(C)C1CCCCC1.O=S(=O)(Cl)Cl.
What is the InChIKey of tert-butylcyclohexane;sulfuryl dichloride?
The InChIKey is SQQKRLXLFSAEGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.Cl2O2S/c1-10(2,3)9-7-5-4-6-8-9;1-5(2,3)4/h9H,4-8H2,1-3H3;.
What are the key properties of tert-butylcyclohexane;sulfuryl dichloride?
tert-butylcyclohexane;sulfuryl dichloride has a molecular weight of 275.24 g/mol, XLogP of 4.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylcyclohexane;sulfuryl dichloride is sourced from PubChem (CID 175416889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).