C16H35NO2 — CID 162724890
2-amino-2-methylpropanoic acid;tert-butylcyclohexane;ethane (PubChem CID 162724890) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is 2-amino-2-methylpropanoic acid;tert-butylcyclohexane;ethane.
| Compound Name | 2-amino-2-methylpropanoic acid;tert-butylcyclohexane;ethane |
|---|---|
| PubChem CID | 162724890 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | 2-amino-2-methylpropanoic acid;tert-butylcyclohexane;ethane |
| SMILES | CC.CC(C)(C)C1CCCCC1.CC(C)(N)C(=O)O |
| InChI | InChI=1S/C10H20.C4H9NO2.C2H6/c1-10(2,3)9-7-5-4-6-8-9;1-4(2,5)3(6)7;1-2/h9H,4-8H2,1-3H3;5H2,1-2H3,(H,6,7);1-2H3 |
| InChIKey | GOVBLDSKDAXYAC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |