2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid

C10H18FNO2 — CID 105455425

IUPAC2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid
SMILESCC(C)(F)C(N)(C(=O)O)C1CCCC1
InChIInChI=1S/C10H18FNO2/c1-9(2,11)10(12,8(13)14)7-5-3-4-6-7/h7H,3-6,12H2,1-2H3,(H,13,14)
InChIKeyCVHPFBLSFNWZHB-UHFFFAOYSA-N
MW203.26 g/mol
LogP1.71
Rot. Bonds3

About 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid

2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid (PubChem CID 105455425) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid.

Molecular Properties

Compound Name2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid
PubChem CID105455425
Molecular FormulaC10H18FNO2
Molecular Weight203.26 g/mol
Exact Mass203.13
IUPAC Name2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid
SMILESCC(C)(F)C(N)(C(=O)O)C1CCCC1
InChIInChI=1S/C10H18FNO2/c1-9(2,11)10(12,8(13)14)7-5-3-4-6-7/h7H,3-6,12H2,1-2H3,(H,13,14)
InChIKeyCVHPFBLSFNWZHB-UHFFFAOYSA-N
XLogP1.71
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.26
LogP ≤ 51.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-amino-2-cyclopropyl-3,3-dimethylbutanoic acid
CID 83695508
2-amino-2-cyclohexyl-2-fluoroacetic acid
CID 176668442
(2S)-2-amino-2-cyclopentylpropanoic acid;hydrochloride
CID 66824792
2-amino-3,3,3-trifluoro-2-(4-methylcyclohexyl)propanoic acid
CID 64774277
2-amino-2-methylpropanoic acid;tert-butylcyclohexane;ethane
CID 162724890
(2S)-2-amino-2-cyclohexyl-2-cyclopentylacetic acid
CID 67022454
(2S)-2-cyclohexyl-2-fluoropropanamide
CID 97455861
3-cyclobutyl-3-fluoro-2,2-dimethylbutanoic acid
CID 105443208
3-amino-3-cyclopentylbutanoic acid
CID 55295139
(3R)-3-amino-3-cyclopentylbutanoic acid
CID 55294909
(2R)-2-amino-2-(2-methylcyclohexyl)propanoic acid
CID 172766899
2-chlorosulfonyl-2-cyclopentylpropanoic acid
CID 87951583

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid?
The IUPAC name of 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid (CID 105455425) is 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid.
What is the SMILES notation for 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid?
The canonical SMILES for 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid is CC(C)(F)C(N)(C(=O)O)C1CCCC1.
What is the InChIKey of 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid?
The InChIKey is CVHPFBLSFNWZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18FNO2/c1-9(2,11)10(12,8(13)14)7-5-3-4-6-7/h7H,3-6,12H2,1-2H3,(H,13,14).
What are the key properties of 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid?
2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid has a molecular weight of 203.26 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-cyclopentyl-3-fluoro-3-methylbutanoic acid is sourced from PubChem (CID 105455425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).