C10H16F3NO2 — CID 64774277
2-amino-3,3,3-trifluoro-2-(4-methylcyclohexyl)propanoic acid (PubChem CID 64774277) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-2-(4-methylcyclohexyl)propanoic acid.
| Compound Name | 2-amino-3,3,3-trifluoro-2-(4-methylcyclohexyl)propanoic acid |
|---|---|
| PubChem CID | 64774277 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-2-(4-methylcyclohexyl)propanoic acid |
| SMILES | CC1CCC(C(N)(C(=O)O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16F3NO2/c1-6-2-4-7(5-3-6)9(14,8(15)16)10(11,12)13/h6-7H,2-5,14H2,1H3,(H,15,16) |
| InChIKey | ZYQSISRAKYLSJA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |