C10H18F3NO2 — CID 164530893
2-aminoacetic acid;1-methyl-4-(trifluoromethyl)cyclohexane (PubChem CID 164530893) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-aminoacetic acid;1-methyl-4-(trifluoromethyl)cyclohexane.
| Compound Name | 2-aminoacetic acid;1-methyl-4-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 164530893 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-aminoacetic acid;1-methyl-4-(trifluoromethyl)cyclohexane |
| SMILES | CC1CCC(C(F)(F)F)CC1.NCC(=O)O |
| InChI | InChI=1S/C8H13F3.C2H5NO2/c1-6-2-4-7(5-3-6)8(9,10)11;3-1-2(4)5/h6-7H,2-5H2,1H3;1,3H2,(H,4,5) |
| InChIKey | OYBUDMVLQZJJLB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |