C11H16F3NO4 — CID 65065934
2-[carboxymethyl-[4-(trifluoromethyl)cyclohexyl]amino]acetic acid (PubChem CID 65065934) has the molecular formula C11H16F3NO4 and a molecular weight of 283.25 g/mol. Its IUPAC name is 2-[carboxymethyl-[4-(trifluoromethyl)cyclohexyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[4-(trifluoromethyl)cyclohexyl]amino]acetic acid |
|---|---|
| PubChem CID | 65065934 |
| Molecular Formula | C11H16F3NO4 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[carboxymethyl-[4-(trifluoromethyl)cyclohexyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H16F3NO4/c12-11(13,14)7-1-3-8(4-2-7)15(5-9(16)17)6-10(18)19/h7-8H,1-6H2,(H,16,17)(H,18,19) |
| InChIKey | HFLFZRKLUXJBCN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |