C14H20F3NO3 — CID 120517533
2-[cyclopropyl-[2-[4-(trifluoromethyl)cyclohexyl]acetyl]amino]acetic acid (PubChem CID 120517533) has the molecular formula C14H20F3NO3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-[4-(trifluoromethyl)cyclohexyl]acetyl]amino]acetic acid.
| Compound Name | 2-[cyclopropyl-[2-[4-(trifluoromethyl)cyclohexyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 120517533 |
| Molecular Formula | C14H20F3NO3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[cyclopropyl-[2-[4-(trifluoromethyl)cyclohexyl]acetyl]amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)CC1CCC(C(F)(F)F)CC1)C1CC1 |
| InChI | InChI=1S/C14H20F3NO3/c15-14(16,17)10-3-1-9(2-4-10)7-12(19)18(8-13(20)21)11-5-6-11/h9-11H,1-8H2,(H,20,21) |
| InChIKey | DVWJFNXLAKILIB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |