C10H17NO2 — CID 43576624
N,2-dicyclopropyl-N-(2-hydroxyethyl)acetamide (PubChem CID 43576624) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N,2-dicyclopropyl-N-(2-hydroxyethyl)acetamide.
| Compound Name | N,2-dicyclopropyl-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 43576624 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N,2-dicyclopropyl-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(CC1CC1)N(CCO)C1CC1 |
| InChI | InChI=1S/C10H17NO2/c12-6-5-11(9-3-4-9)10(13)7-8-1-2-8/h8-9,12H,1-7H2 |
| InChIKey | ZGDVDFWERNCRLV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |