C12H20ClNO — CID 103166954
N-(2-chloroethyl)-N,2-di(cyclobutyl)acetamide (PubChem CID 103166954) has the molecular formula C12H20ClNO and a molecular weight of 229.75 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,2-di(cyclobutyl)acetamide.
| Compound Name | N-(2-chloroethyl)-N,2-di(cyclobutyl)acetamide |
|---|---|
| PubChem CID | 103166954 |
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-(2-chloroethyl)-N,2-di(cyclobutyl)acetamide |
| SMILES | O=C(CC1CCC1)N(CCCl)C1CCC1 |
| InChI | InChI=1S/C12H20ClNO/c13-7-8-14(11-5-2-6-11)12(15)9-10-3-1-4-10/h10-11H,1-9H2 |
| InChIKey | NUPCMMKAMRZUSJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|