C17H30ClNO — CID 63391329
N-(2-chloroethyl)-N,3-dicyclohexylpropanamide (PubChem CID 63391329) has the molecular formula C17H30ClNO and a molecular weight of 299.89 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,3-dicyclohexylpropanamide.
| Compound Name | N-(2-chloroethyl)-N,3-dicyclohexylpropanamide |
|---|---|
| PubChem CID | 63391329 |
| Molecular Formula | C17H30ClNO |
| Molecular Weight | 299.89 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-(2-chloroethyl)-N,3-dicyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)N(CCCl)C1CCCCC1 |
| InChI | InChI=1S/C17H30ClNO/c18-13-14-19(16-9-5-2-6-10-16)17(20)12-11-15-7-3-1-4-8-15/h15-16H,1-14H2 |
| InChIKey | QRHNLALTFYNCAT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|