About 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane
3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane (PubChem CID 164530936) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane.
Molecular Properties
| Compound Name | 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane |
| PubChem CID | 164530936 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane |
| SMILES | C=C(O)CN.CC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H13F3.C3H7NO/c1-6-2-4-7(5-3-6)8(9,10)11;1-3(5)2-4/h6-7H,2-5H2,1H3;5H,1-2,4H2 |
| InChIKey | NFTUXZCINVEKMC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane?
The IUPAC name of 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane (CID 164530936) is 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane.
What is the SMILES notation for 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane?
The canonical SMILES for 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane is C=C(O)CN.CC1CCC(C(F)(F)F)CC1.
What is the InChIKey of 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane?
The InChIKey is NFTUXZCINVEKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3.C3H7NO/c1-6-2-4-7(5-3-6)8(9,10)11;1-3(5)2-4/h6-7H,2-5H2,1H3;5H,1-2,4H2.
What are the key properties of 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane?
3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane has a molecular weight of 239.28 g/mol, XLogP of 3.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminoprop-1-en-2-ol;1-methyl-4-(trifluoromethyl)cyclohexane is sourced from PubChem (CID 164530936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).