C11H17F3O2 — CID 84736757
2-methyl-2-[4-(trifluoromethyl)cyclohexyl]propanoic acid (PubChem CID 84736757) has the molecular formula C11H17F3O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-methyl-2-[4-(trifluoromethyl)cyclohexyl]propanoic acid.
| Compound Name | 2-methyl-2-[4-(trifluoromethyl)cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 84736757 |
| Molecular Formula | C11H17F3O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-methyl-2-[4-(trifluoromethyl)cyclohexyl]propanoic acid |
| SMILES | CC(C)(C(=O)O)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3O2/c1-10(2,9(15)16)7-3-5-8(6-4-7)11(12,13)14/h7-8H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | BEKYBGOWRWCQET-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |