C13H26ClNO2 — CID 70289577
2-amino-2-(4-tert-butylcyclohexyl)propanoic acid;hydrochloride (PubChem CID 70289577) has the molecular formula C13H26ClNO2 and a molecular weight of 263.81 g/mol. Its IUPAC name is 2-amino-2-(4-tert-butylcyclohexyl)propanoic acid;hydrochloride.
| Compound Name | 2-amino-2-(4-tert-butylcyclohexyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70289577 |
| Molecular Formula | C13H26ClNO2 |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-amino-2-(4-tert-butylcyclohexyl)propanoic acid;hydrochloride |
| SMILES | CC(C)(C)C1CCC(C(C)(N)C(=O)O)CC1.Cl |
| InChI | InChI=1S/C13H25NO2.ClH/c1-12(2,3)9-5-7-10(8-6-9)13(4,14)11(15)16;/h9-10H,5-8,14H2,1-4H3,(H,15,16);1H |
| InChIKey | YJWUGWQNDFYKNB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |