About acetic acid;tert-butylcyclohexane
acetic acid;tert-butylcyclohexane (PubChem CID 69013500) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is acetic acid;tert-butylcyclohexane.
Molecular Properties
| Compound Name | acetic acid;tert-butylcyclohexane |
| PubChem CID | 69013500 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | acetic acid;tert-butylcyclohexane |
| SMILES | CC(=O)O.CC(C)(C)C1CCCCC1 |
| InChI | InChI=1S/C10H20.C2H4O2/c1-10(2,3)9-7-5-4-6-8-9;1-2(3)4/h9H,4-8H2,1-3H3;1H3,(H,3,4) |
| InChIKey | IMCLIWACKXIDDY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;tert-butylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;tert-butylcyclohexane?
The IUPAC name of acetic acid;tert-butylcyclohexane (CID 69013500) is acetic acid;tert-butylcyclohexane.
What is the SMILES notation for acetic acid;tert-butylcyclohexane?
The canonical SMILES for acetic acid;tert-butylcyclohexane is CC(=O)O.CC(C)(C)C1CCCCC1.
What is the InChIKey of acetic acid;tert-butylcyclohexane?
The InChIKey is IMCLIWACKXIDDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C2H4O2/c1-10(2,3)9-7-5-4-6-8-9;1-2(3)4/h9H,4-8H2,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;tert-butylcyclohexane?
acetic acid;tert-butylcyclohexane has a molecular weight of 200.32 g/mol, XLogP of 3.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;tert-butylcyclohexane is sourced from PubChem (CID 69013500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).