C20H38 — CID 163468164
6-tert-butylbicyclo[3.1.0]hexane;tert-butylcyclohexane (PubChem CID 163468164) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is 6-tert-butylbicyclo[3.1.0]hexane;tert-butylcyclohexane.
| Compound Name | 6-tert-butylbicyclo[3.1.0]hexane;tert-butylcyclohexane |
|---|---|
| PubChem CID | 163468164 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | 6-tert-butylbicyclo[3.1.0]hexane;tert-butylcyclohexane |
| SMILES | CC(C)(C)C1C2CCCC21.CC(C)(C)C1CCCCC1 |
| InChI | InChI=1S/C10H18.C10H20/c1-10(2,3)9-7-5-4-6-8(7)9;1-10(2,3)9-7-5-4-6-8-9/h7-9H,4-6H2,1-3H3;9H,4-8H2,1-3H3 |
| InChIKey | BUISDYNBCGTEGA-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |