C20H41N — CID 162008931
tert-butylcyclohexane;4-tert-butyl-1-methylpiperidine (PubChem CID 162008931) has the molecular formula C20H41N and a molecular weight of 295.56 g/mol. Its IUPAC name is tert-butylcyclohexane;4-tert-butyl-1-methylpiperidine.
| Compound Name | tert-butylcyclohexane;4-tert-butyl-1-methylpiperidine |
|---|---|
| PubChem CID | 162008931 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | tert-butylcyclohexane;4-tert-butyl-1-methylpiperidine |
| SMILES | CC(C)(C)C1CCCCC1.CN1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C10H21N.C10H20/c1-10(2,3)9-5-7-11(4)8-6-9;1-10(2,3)9-7-5-4-6-8-9/h9H,5-8H2,1-4H3;9H,4-8H2,1-3H3 |
| InChIKey | YTEZHSYHWVGGCY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |