About 1-tert-butyl-4-methylcyclohexane;methane;propane
1-tert-butyl-4-methylcyclohexane;methane;propane (PubChem CID 143180691) has the molecular formula C15H34
and a molecular weight of 214.44 g/mol. Its IUPAC name is 1-tert-butyl-4-methylcyclohexane;methane;propane.
Molecular Properties
| Compound Name | 1-tert-butyl-4-methylcyclohexane;methane;propane |
| PubChem CID | 143180691 |
| Molecular Formula | C15H34 |
| Molecular Weight | 214.44 g/mol |
| Exact Mass | 214.27 |
| IUPAC Name | 1-tert-butyl-4-methylcyclohexane;methane;propane |
| SMILES | C.CC1CCC(C(C)(C)C)CC1.CCC |
| InChI | InChI=1S/C11H22.C3H8.CH4/c1-9-5-7-10(8-6-9)11(2,3)4;1-3-2;/h9-10H,5-8H2,1-4H3;3H2,1-2H3;1H4 |
| InChIKey | RMHCVIHUBDPKOR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-4-methylcyclohexane;methane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-methylcyclohexane;methane;propane?
The IUPAC name of 1-tert-butyl-4-methylcyclohexane;methane;propane (CID 143180691) is 1-tert-butyl-4-methylcyclohexane;methane;propane.
What is the SMILES notation for 1-tert-butyl-4-methylcyclohexane;methane;propane?
The canonical SMILES for 1-tert-butyl-4-methylcyclohexane;methane;propane is C.CC1CCC(C(C)(C)C)CC1.CCC.
What is the InChIKey of 1-tert-butyl-4-methylcyclohexane;methane;propane?
The InChIKey is RMHCVIHUBDPKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22.C3H8.CH4/c1-9-5-7-10(8-6-9)11(2,3)4;1-3-2;/h9-10H,5-8H2,1-4H3;3H2,1-2H3;1H4.
What are the key properties of 1-tert-butyl-4-methylcyclohexane;methane;propane?
1-tert-butyl-4-methylcyclohexane;methane;propane has a molecular weight of 214.44 g/mol, XLogP of 5.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-methylcyclohexane;methane;propane is sourced from PubChem (CID 143180691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).