About methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane
methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane (PubChem CID 160612898) has the molecular formula C18H36
and a molecular weight of 252.49 g/mol. Its IUPAC name is methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane.
Molecular Properties
| Compound Name | methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane |
| PubChem CID | 160612898 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane |
| SMILES | C.CC1CCC(C(C)(C)C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C17H32.CH4/c1-13-5-9-15(10-6-13)17(3,4)16-11-7-14(2)8-12-16;/h13-16H,5-12H2,1-4H3;1H4 |
| InChIKey | RFSCJIZBQJUTFD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane?
The IUPAC name of methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane (CID 160612898) is methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane.
What is the SMILES notation for methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane?
The canonical SMILES for methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane is C.CC1CCC(C(C)(C)C2CCC(C)CC2)CC1.
What is the InChIKey of methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane?
The InChIKey is RFSCJIZBQJUTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32.CH4/c1-13-5-9-15(10-6-13)17(3,4)16-11-7-14(2)8-12-16;/h13-16H,5-12H2,1-4H3;1H4.
What are the key properties of methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane?
methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane has a molecular weight of 252.49 g/mol, XLogP of 6.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexane is sourced from PubChem (CID 160612898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).