C18H34O — CID 79423962
4-tert-butyl-2-(3,5-dimethylcyclohexyl)cyclohexan-1-ol (PubChem CID 79423962) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is 4-tert-butyl-2-(3,5-dimethylcyclohexyl)cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-2-(3,5-dimethylcyclohexyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79423962 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | 4-tert-butyl-2-(3,5-dimethylcyclohexyl)cyclohexan-1-ol |
| SMILES | CC1CC(C)CC(C2CC(C(C)(C)C)CCC2O)C1 |
| InChI | InChI=1S/C18H34O/c1-12-8-13(2)10-14(9-12)16-11-15(18(3,4)5)6-7-17(16)19/h12-17,19H,6-11H2,1-5H3 |
| InChIKey | DOKBATZAENRTAQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |