C15H30O — CID 7037526
trans-(2R,6R)-2,6-ditert-butyl-4-methylcyclohexan-1-ol (PubChem CID 7037526) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is trans-(2R,6R)-2,6-ditert-butyl-4-methylcyclohexan-1-ol.
| Compound Name | trans-(2R,6R)-2,6-ditert-butyl-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 7037526 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | trans-(2R,6R)-2,6-ditert-butyl-4-methylcyclohexan-1-ol |
| SMILES | CC1C[C@H](C(C)(C)C)C(O)[C@@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C15H30O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h10-13,16H,8-9H2,1-7H3/t10?,11-,12-,13?/m0/s1 |
| InChIKey | OIXQKWDQCODZGF-ZFQMDJOTSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |