About 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol
2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol (PubChem CID 123258751) has the molecular formula C29H56O2
and a molecular weight of 436.77 g/mol. Its IUPAC name is 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol.
Molecular Properties
| Compound Name | 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol |
| PubChem CID | 123258751 |
| Molecular Formula | C29H56O2 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.43 |
| IUPAC Name | 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol |
| SMILES | CC(C)(C)C1CCC(C2CC(C(C)(C)C)C(O)C(C(C)(C)C)C2)CC(C(C)(C)C)C1O |
| InChI | InChI=1S/C29H56O2/c1-26(2,3)20-14-13-18(15-21(24(20)30)27(4,5)6)19-16-22(28(7,8)9)25(31)23(17-19)29(10,11)12/h18-25,30-31H,13-17H2,1-12H3 |
| InChIKey | OJTFGHYDHDWISA-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol?
The IUPAC name of 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol (CID 123258751) is 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol.
What is the SMILES notation for 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol?
The canonical SMILES for 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol is CC(C)(C)C1CCC(C2CC(C(C)(C)C)C(O)C(C(C)(C)C)C2)CC(C(C)(C)C)C1O.
What is the InChIKey of 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol?
The InChIKey is OJTFGHYDHDWISA-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H56O2/c1-26(2,3)20-14-13-18(15-21(24(20)30)27(4,5)6)19-16-22(28(7,8)9)25(31)23(17-19)29(10,11)12/h18-25,30-31H,13-17H2,1-12H3.
What are the key properties of 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol?
2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol has a molecular weight of 436.77 g/mol, XLogP of 7.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxycyclohexyl)cycloheptan-1-ol is sourced from PubChem (CID 123258751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).