C11H20O — CID 171582038
(2R,3R)-3-tert-butylbicyclo[2.2.1]heptan-2-ol (PubChem CID 171582038) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (2R,3R)-3-tert-butylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (2R,3R)-3-tert-butylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 171582038 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (2R,3R)-3-tert-butylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC(C)(C)[C@H]1C2CCC(C2)[C@H]1O |
| InChI | InChI=1S/C11H20O/c1-11(2,3)9-7-4-5-8(6-7)10(9)12/h7-10,12H,4-6H2,1-3H3/t7?,8?,9-,10+/m0/s1 |
| InChIKey | ZUAIKPONDYBOTA-HORUIINNSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |