C11H18O2 — CID 12673622
tricyclo[4.3.1.13,8]undecane-2,7-diol (PubChem CID 12673622) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is tricyclo[4.3.1.13,8]undecane-2,7-diol.
| Compound Name | tricyclo[4.3.1.13,8]undecane-2,7-diol |
|---|---|
| PubChem CID | 12673622 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | tricyclo[4.3.1.13,8]undecane-2,7-diol |
| SMILES | OC1C2CCC3CC1CC(C2)C3O |
| InChI | InChI=1S/C11H18O2/c12-10-6-1-2-7-4-9(10)5-8(3-6)11(7)13/h6-13H,1-5H2 |
| InChIKey | LFVBVHBJOCGBSN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |