C10H16 — CID 134081586
(2R,6R)-tricyclo[4.2.1.12,5]decane (PubChem CID 134081586) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (2R,6R)-tricyclo[4.2.1.12,5]decane.
| Compound Name | (2R,6R)-tricyclo[4.2.1.12,5]decane |
|---|---|
| PubChem CID | 134081586 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (2R,6R)-tricyclo[4.2.1.12,5]decane |
| SMILES | C1C[C@@H]2CC1[C@@H]1CCC2C1 |
| InChI | InChI=1S/C10H16/c1-2-8-5-7(1)9-3-4-10(8)6-9/h7-10H,1-6H2/t7-,8?,9?,10-/m1/s1 |
| InChIKey | RKBXEEWDGKTVPH-SEZDTBSWSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |