About bicyclo[3.1.0]hexane;dihydrochloride
bicyclo[3.1.0]hexane;dihydrochloride (PubChem CID 141306080) has the molecular formula C6H12Cl2
and a molecular weight of 155.07 g/mol. Its IUPAC name is bicyclo[3.1.0]hexane;dihydrochloride.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexane;dihydrochloride |
| PubChem CID | 141306080 |
| Molecular Formula | C6H12Cl2 |
| Molecular Weight | 155.07 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | bicyclo[3.1.0]hexane;dihydrochloride |
| SMILES | C1CC2CC2C1.Cl.Cl |
| InChI | InChI=1S/C6H10.2ClH/c1-2-5-4-6(5)3-1;;/h5-6H,1-4H2;2*1H |
| InChIKey | GHZQXRFXWVNAHS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.07 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bicyclo[3.1.0]hexane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexane;dihydrochloride?
The IUPAC name of bicyclo[3.1.0]hexane;dihydrochloride (CID 141306080) is bicyclo[3.1.0]hexane;dihydrochloride.
What is the SMILES notation for bicyclo[3.1.0]hexane;dihydrochloride?
The canonical SMILES for bicyclo[3.1.0]hexane;dihydrochloride is C1CC2CC2C1.Cl.Cl.
What is the InChIKey of bicyclo[3.1.0]hexane;dihydrochloride?
The InChIKey is GHZQXRFXWVNAHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10.2ClH/c1-2-5-4-6(5)3-1;;/h5-6H,1-4H2;2*1H.
What are the key properties of bicyclo[3.1.0]hexane;dihydrochloride?
bicyclo[3.1.0]hexane;dihydrochloride has a molecular weight of 155.07 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexane;dihydrochloride is sourced from PubChem (CID 141306080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).