C8H12 — CID 124938048
(1S,2S,4S,5S)-tricyclo[3.2.1.02,4]octane (PubChem CID 124938048) has the molecular formula C8H12 and a molecular weight of 108.18 g/mol. Its IUPAC name is (1S,2S,4S,5S)-tricyclo[3.2.1.02,4]octane.
| Compound Name | (1S,2S,4S,5S)-tricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 124938048 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | (1S,2S,4S,5S)-tricyclo[3.2.1.02,4]octane |
| SMILES | C1C[C@H]2C[C@H]1[C@@H]1C[C@@H]21 |
| InChI | InChI=1S/C8H12/c1-2-6-3-5(1)7-4-8(6)7/h5-8H,1-4H2/t5-,6-,7-,8-/m0/s1 |
| InChIKey | PSZPCAFRANQPLS-XAMCCFCMSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |