C13H18 — CID 163947804
pentacyclo[6.4.1.02,6.03,13.05,11]tridecane (PubChem CID 163947804) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is pentacyclo[6.4.1.02,6.03,13.05,11]tridecane.
| Compound Name | pentacyclo[6.4.1.02,6.03,13.05,11]tridecane |
|---|---|
| PubChem CID | 163947804 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | pentacyclo[6.4.1.02,6.03,13.05,11]tridecane |
| SMILES | C1CC2CC3C4CC5C2C(CC14)C35 |
| InChI | InChI=1S/C13H18/c1-2-7-4-9-8-5-11-12(7)10(13(9)11)3-6(1)8/h6-13H,1-5H2 |
| InChIKey | RWRGYRDAWHMRTO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |