C16H24 — CID 163955240
pentacyclo[9.3.1.15,8.02,14.03,10]hexadecane (PubChem CID 163955240) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is pentacyclo[9.3.1.15,8.02,14.03,10]hexadecane.
| Compound Name | pentacyclo[9.3.1.15,8.02,14.03,10]hexadecane |
|---|---|
| PubChem CID | 163955240 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | pentacyclo[9.3.1.15,8.02,14.03,10]hexadecane |
| SMILES | C1CC2CC1CC1C3CCC4C(C3)C4C1C2 |
| InChI | InChI=1S/C16H24/c1-2-10-5-9(1)6-13-11-3-4-12-15(8-11)16(12)14(13)7-10/h9-16H,1-8H2 |
| InChIKey | SCTXBCCODMTDKF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |