C11H16 — CID 143721490
tetracyclo[6.2.1.02,5.04,6]undecane (PubChem CID 143721490) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is tetracyclo[6.2.1.02,5.04,6]undecane.
| Compound Name | tetracyclo[6.2.1.02,5.04,6]undecane |
|---|---|
| PubChem CID | 143721490 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | tetracyclo[6.2.1.02,5.04,6]undecane |
| SMILES | C1CC2CC1CC1C3CC2C13 |
| InChI | InChI=1S/C11H16/c1-2-7-3-6(1)4-9-10-5-8(7)11(9)10/h6-11H,1-5H2 |
| InChIKey | HLMYNBJLPLVBOO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |