C20H32 — CID 123771301
2-(2-bicyclo[2.2.1]heptanyl)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalene (PubChem CID 123771301) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalene.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalene |
|---|---|
| PubChem CID | 123771301 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalene |
| SMILES | C1CC2CCCC3CC(C4CC5CCC4C5)CC(C1)C23 |
| InChI | InChI=1S/C20H32/c1-3-14-4-2-6-17-12-18(11-16(5-1)20(14)17)19-10-13-7-8-15(19)9-13/h13-20H,1-12H2 |
| InChIKey | IULYZXFLPAVYAV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |