About tetracyclo[8.2.1.02,9.03,7]tridecane
tetracyclo[8.2.1.02,9.03,7]tridecane (PubChem CID 117070325) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is tetracyclo[8.2.1.02,9.03,7]tridecane.
Molecular Properties
| Compound Name | tetracyclo[8.2.1.02,9.03,7]tridecane |
| PubChem CID | 117070325 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | tetracyclo[8.2.1.02,9.03,7]tridecane |
| SMILES | C1CC2CC3C4CCC(C4)C3C2C1 |
| InChI | InChI=1S/C13H20/c1-2-8-7-12-9-4-5-10(6-9)13(12)11(8)3-1/h8-13H,1-7H2 |
| InChIKey | FONGDJLYNQZXKW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetracyclo[8.2.1.02,9.03,7]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[8.2.1.02,9.03,7]tridecane?
The IUPAC name of tetracyclo[8.2.1.02,9.03,7]tridecane (CID 117070325) is tetracyclo[8.2.1.02,9.03,7]tridecane.
What is the SMILES notation for tetracyclo[8.2.1.02,9.03,7]tridecane?
The canonical SMILES for tetracyclo[8.2.1.02,9.03,7]tridecane is C1CC2CC3C4CCC(C4)C3C2C1.
What is the InChIKey of tetracyclo[8.2.1.02,9.03,7]tridecane?
The InChIKey is FONGDJLYNQZXKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20/c1-2-8-7-12-9-4-5-10(6-9)13(12)11(8)3-1/h8-13H,1-7H2.
What are the key properties of tetracyclo[8.2.1.02,9.03,7]tridecane?
tetracyclo[8.2.1.02,9.03,7]tridecane has a molecular weight of 176.30 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[8.2.1.02,9.03,7]tridecane is sourced from PubChem (CID 117070325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).