C15H24 — CID 13164121
tetracyclo[10.2.1.05,14.08,13]pentadecane (PubChem CID 13164121) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is tetracyclo[10.2.1.05,14.08,13]pentadecane.
| Compound Name | tetracyclo[10.2.1.05,14.08,13]pentadecane |
|---|---|
| PubChem CID | 13164121 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | tetracyclo[10.2.1.05,14.08,13]pentadecane |
| SMILES | C1CC2CCC3CCCC4CC(C1)C2C34 |
| InChI | InChI=1S/C15H24/c1-3-10-7-8-11-4-2-6-13-9-12(5-1)14(10)15(11)13/h10-15H,1-9H2 |
| InChIKey | XQQQJTDFUATYIG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |