C14H20 — CID 124764509
(1S,4S,7S,10S)-pentacyclo[8.2.1.14,7.02,9.03,8]tetradecane (PubChem CID 124764509) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (1S,4S,7S,10S)-pentacyclo[8.2.1.14,7.02,9.03,8]tetradecane.
| Compound Name | (1S,4S,7S,10S)-pentacyclo[8.2.1.14,7.02,9.03,8]tetradecane |
|---|---|
| PubChem CID | 124764509 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (1S,4S,7S,10S)-pentacyclo[8.2.1.14,7.02,9.03,8]tetradecane |
| SMILES | C1C[C@H]2C[C@H]1C1C2C2C1[C@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C14H20/c1-2-8-5-7(1)11-12(8)14-10-4-3-9(6-10)13(11)14/h7-14H,1-6H2/t7-,8-,9-,10-,11?,12?,13?,14?/m0/s1 |
| InChIKey | USKKQUSCOMQNOQ-MTGZYYMASA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'} |
|---|