C16H22N2 — CID 11869187
(2S,3S,6R,7R,9R,10R,13S,14R)-15,16-diazahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadec-15-ene (PubChem CID 11869187) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (2S,3S,6R,7R,9R,10R,13S,14R)-15,16-diazahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadec-15-ene.
| Compound Name | (2S,3S,6R,7R,9R,10R,13S,14R)-15,16-diazahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadec-15-ene |
|---|---|
| PubChem CID | 11869187 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (2S,3S,6R,7R,9R,10R,13S,14R)-15,16-diazahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadec-15-ene |
| SMILES | C1C[C@H]2C[C@@H]1[C@H]1C3N=NC([C@H]21)[C@H]1[C@H]2CC[C@H](C2)[C@@H]31 |
| InChI | InChI=1S/C16H22N2/c1-2-8-5-7(1)11-12(8)16-14-10-4-3-9(6-10)13(14)15(11)17-18-16/h7-16H,1-6H2/t7-,8+,9-,10+,11-,12-,13-,14+,15?,16?/m1/s1 |
| InChIKey | CCSVCVPORNVFLO-WVJSVOLVSA-N |
| XLogP | 3.53 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |