C12H18N2 — CID 13222111
(1S,2R,3R,6S,7S,8R)-12,12-dimethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 13222111) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (1S,2R,3R,6S,7S,8R)-12,12-dimethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | (1S,2R,3R,6S,7S,8R)-12,12-dimethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 13222111 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (1S,2R,3R,6S,7S,8R)-12,12-dimethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | CC1(C)[C@@H]2N=N[C@H]1[C@H]1[C@@H]3CC[C@@H](C3)[C@H]12 |
| InChI | InChI=1S/C12H18N2/c1-12(2)10-8-6-3-4-7(5-6)9(8)11(12)14-13-10/h6-11H,3-5H2,1-2H3/t6-,7+,8+,9-,10+,11- |
| InChIKey | HZUFYUSAIKZXNE-MXULBQIISA-N |
| XLogP | 2.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|