About 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene
12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene (PubChem CID 572172) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene.
Analyze 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene?
The IUPAC name of 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene (CID 572172) is 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene.
What is the SMILES notation for 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene?
The canonical SMILES for 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene is CC1(C)C2N=NC1C1CCCCCC12.
What is the InChIKey of 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene?
The InChIKey is PPPLDPFSNCLDQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-12(2)10-8-6-4-3-5-7-9(8)11(12)14-13-10/h8-11H,3-7H2,1-2H3.
What are the key properties of 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene?
12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene has a molecular weight of 192.31 g/mol, XLogP of 3.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12,12-dimethyl-10,11-diazatricyclo[7.2.1.02,8]dodec-10-ene is sourced from PubChem (CID 572172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).