C13H24 — CID 71443320
11,11-dimethylbicyclo[4.4.1]undecane (PubChem CID 71443320) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 11,11-dimethylbicyclo[4.4.1]undecane.
| Compound Name | 11,11-dimethylbicyclo[4.4.1]undecane |
|---|---|
| PubChem CID | 71443320 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 11,11-dimethylbicyclo[4.4.1]undecane |
| SMILES | CC1(C)C2CCCCC1CCCC2 |
| InChI | InChI=1S/C13H24/c1-13(2)11-7-3-4-8-12(13)10-6-5-9-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | OVXIPNHJQJQNDO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |